C9H10ClNO6 — CID 46876239
3-chloro-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrole-2,5-dione (PubChem CID 46876239) has the molecular formula C9H10ClNO6 and a molecular weight of 263.63 g/mol. Its IUPAC name is 3-chloro-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 46876239 |
| Molecular Formula | C9H10ClNO6 |
| Molecular Weight | 263.63 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 3-chloro-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Cl)C(=O)N1C1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H10ClNO6/c10-3-1-5(13)11(8(3)16)9-7(15)6(14)4(2-12)17-9/h1,4,6-7,9,12,14-15H,2H2/t4-,6-,7-,9?/m1/s1 |
| InChIKey | VBMVZXCACVTJQN-HSRVFOSPSA-N |
| XLogP | -2.08 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.63 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|