C16H16N4O9 — CID 177270638
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6,8-dioxopurin-9-yl)oxolan-2-yl]methyl acetate (PubChem CID 177270638) has the molecular formula C16H16N4O9 and a molecular weight of 408.32 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6,8-dioxopurin-9-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6,8-dioxopurin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 177270638 |
| Molecular Formula | C16H16N4O9 |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6,8-dioxopurin-9-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](N2C(=O)N=C3C(=O)N=CN=C32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H16N4O9/c1-6(21)26-4-9-11(27-7(2)22)12(28-8(3)23)15(29-9)20-13-10(19-16(20)25)14(24)18-5-17-13/h5,9,11-12,15H,4H2,1-3H3/t9-,11-,12-,15-/m1/s1 |
| InChIKey | UDYKUGDDWOZKGJ-SDBHATRESA-N |
| XLogP | -1.02 |
| TPSA | 162.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|