C20H22N10O10 — CID 157423768
9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-iminopurine-6,8-dione (PubChem CID 157423768) has the molecular formula C20H22N10O10 and a molecular weight of 562.46 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-iminopurine-6,8-dione.
| Compound Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-iminopurine-6,8-dione |
|---|---|
| PubChem CID | 157423768 |
| Molecular Formula | C20H22N10O10 |
| Molecular Weight | 562.46 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-iminopurine-6,8-dione |
| SMILES | [H]/N=C1/N=C2C(=NC(=O)N2[C@H]2C[C@H](O)[C@@H](CO)O2)C(=O)N1.[H]/N=C1/N=C2C(=NC(=O)N2[C@H]2C[C@H](O)[C@@H](CO)O2)C(=O)N1 |
| InChI | InChI=1S/2C10H11N5O5/c2*11-9-13-7-6(8(18)14-9)12-10(19)15(7)5-1-3(17)4(2-16)20-5/h2*3-5,16-17H,1-2H2,(H2,11,14,18)/t2*3-,4+,5+/m00/s1 |
| InChIKey | BPSJBDUVSSRZLF-IBVPOFDWSA-N |
| XLogP | -4.41 |
| TPSA | 295.34 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.46 |
| LogP ≤ 5 | -4.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|