C10H10N4O4S — CID 87921730
9-[(2R,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-sulfanylidenepurin-8-one (PubChem CID 87921730) has the molecular formula C10H10N4O4S and a molecular weight of 282.28 g/mol. Its IUPAC name is 9-[(2R,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-sulfanylidenepurin-8-one.
| Compound Name | 9-[(2R,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-sulfanylidenepurin-8-one |
|---|---|
| PubChem CID | 87921730 |
| Molecular Formula | C10H10N4O4S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 9-[(2R,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-sulfanylidenepurin-8-one |
| SMILES | O=C1N=C2C=NC(=S)N=C2N1[C@H]1C[C@@H](O)[C@H](CO)O1 |
| InChI | InChI=1S/C10H10N4O4S/c15-3-6-5(16)1-7(18-6)14-8-4(12-10(14)17)2-11-9(19)13-8/h2,5-7,15-16H,1,3H2/t5-,6+,7-/m1/s1 |
| InChIKey | NACCINFRGLPVST-DSYKOEDSSA-N |
| XLogP | -0.90 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|