C9H13N3O4S — CID 175676291
2-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one (PubChem CID 175676291) has the molecular formula C9H13N3O4S and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one.
| Compound Name | 2-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 175676291 |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one |
| SMILES | Cc1nn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C9H13N3O4S/c1-4-8(17)10-9(15)12(11-4)7-2-5(14)6(3-13)16-7/h5-7,13-14H,2-3H2,1H3,(H,10,15,17)/t5-,6+,7+/m0/s1 |
| InChIKey | GNQWFAHOEIVPKJ-RRKCRQDMSA-N |
| XLogP | -0.75 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|