C10H11BrFN3O5 — CID 170897911
6-[(E)-2-bromo-2-fluoroethenyl]-2-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazine-3,5-dione (PubChem CID 170897911) has the molecular formula C10H11BrFN3O5 and a molecular weight of 352.12 g/mol. Its IUPAC name is 6-[(E)-2-bromo-2-fluoroethenyl]-2-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[(E)-2-bromo-2-fluoroethenyl]-2-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 170897911 |
| Molecular Formula | C10H11BrFN3O5 |
| Molecular Weight | 352.12 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 6-[(E)-2-bromo-2-fluoroethenyl]-2-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2C[C@H](O)[C@@H](CO)O2)nc1/C=C(\F)Br |
| InChI | InChI=1S/C10H11BrFN3O5/c11-7(12)1-4-9(18)13-10(19)15(14-4)8-2-5(17)6(3-16)20-8/h1,5-6,8,16-17H,2-3H2,(H,13,18,19)/b7-1-/t5-,6+,8-/m0/s1 |
| InChIKey | PZHAXONLZUCDNN-JAKYWURRSA-N |
| XLogP | -0.76 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.12 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |