C14H19N3O5 — CID 139835523
6-hex-1-ynyl-2-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazine-3,5-dione (PubChem CID 139835523) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is 6-hex-1-ynyl-2-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazine-3,5-dione.
| Compound Name | 6-hex-1-ynyl-2-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 139835523 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 6-hex-1-ynyl-2-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazine-3,5-dione |
| SMILES | CCCCC#Cc1nn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H19N3O5/c1-2-3-4-5-6-9-13(20)15-14(21)17(16-9)12-7-10(19)11(8-18)22-12/h10-12,18-19H,2-4,7-8H2,1H3,(H,15,20,21)/t10-,11+,12+/m0/s1 |
| InChIKey | JOASEFCGEMYNJL-QJPTWQEYSA-N |
| XLogP | -0.89 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|