C21H28N4O5 — CID 135678278
N-[5-hex-1-ynyl-7-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-2-yl]-2-methylpropanamide (PubChem CID 135678278) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[5-hex-1-ynyl-7-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-2-yl]-2-methylpropanamide.
| Compound Name | N-[5-hex-1-ynyl-7-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 135678278 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-[5-hex-1-ynyl-7-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-2-yl]-2-methylpropanamide |
| SMILES | CCCCC#Cc1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c2nc(NC(=O)C(C)C)[nH]c(=O)c12 |
| InChI | InChI=1S/C21H28N4O5/c1-4-5-6-7-8-13-10-25(16-9-14(27)15(11-26)30-16)18-17(13)20(29)24-21(22-18)23-19(28)12(2)3/h10,12,14-16,26-27H,4-6,9,11H2,1-3H3,(H2,22,23,24,28,29)/t14-,15+,16+/m0/s1 |
| InChIKey | ZYOCHJDIKQIJSD-ARFHVFGLSA-N |
| XLogP | 1.50 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|