C25H28N4O4 — CID 159618268
N-[7-[(2R,4R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-4-oxo-5-(2-phenylethynyl)-3H-pyrrolo[2,3-d]pyrimidin-2-yl]-2,2-dimethylpropanamide (PubChem CID 159618268) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[7-[(2R,4R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-4-oxo-5-(2-phenylethynyl)-3H-pyrrolo[2,3-d]pyrimidin-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[7-[(2R,4R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-4-oxo-5-(2-phenylethynyl)-3H-pyrrolo[2,3-d]pyrimidin-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 159618268 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-[7-[(2R,4R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-4-oxo-5-(2-phenylethynyl)-3H-pyrrolo[2,3-d]pyrimidin-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC[C@H]1O[C@@H](n2cc(C#Cc3ccccc3)c3c(=O)[nH]c(NC(=O)C(C)(C)C)nc32)C[C@H]1O |
| InChI | InChI=1S/C25H28N4O4/c1-5-18-17(30)13-19(33-18)29-14-16(12-11-15-9-7-6-8-10-15)20-21(29)26-24(27-22(20)31)28-23(32)25(2,3)4/h6-10,14,17-19,30H,5,13H2,1-4H3,(H2,26,27,28,31,32)/t17-,18-,19-/m1/s1 |
| InChIKey | SGPJOYDPOUKGDF-GUDVDZBRSA-N |
| XLogP | 3.17 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|