C33H38N4O5Si — CID 157461163
2-amino-7-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-(5-oxohex-1-ynyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 157461163) has the molecular formula C33H38N4O5Si and a molecular weight of 598.78 g/mol. Its IUPAC name is 2-amino-7-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-(5-oxohex-1-ynyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-7-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-(5-oxohex-1-ynyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 157461163 |
| Molecular Formula | C33H38N4O5Si |
| Molecular Weight | 598.78 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | 2-amino-7-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-(5-oxohex-1-ynyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | CC(=O)CCC#Cc1cn(C2CC(O)C(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)c2nc(N)[nH]c(=O)c12 |
| InChI | InChI=1S/C33H38N4O5Si/c1-22(38)13-11-12-14-23-20-37(30-29(23)31(40)36-32(34)35-30)28-19-26(39)27(42-28)21-41-43(33(2,3)4,24-15-7-5-8-16-24)25-17-9-6-10-18-25/h5-10,15-18,20,26-28,39H,11,13,19,21H2,1-4H3,(H3,34,35,36,40) |
| InChIKey | QWSKVZVRDXSGBQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.78 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|