C9H13N5O5 — CID 177462805
(1E)-1-[3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,5-dioxoimidazolidin-4-ylidene]guanidine (PubChem CID 177462805) has the molecular formula C9H13N5O5 and a molecular weight of 271.23 g/mol. Its IUPAC name is (1E)-1-[3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,5-dioxoimidazolidin-4-ylidene]guanidine.
| Compound Name | (1E)-1-[3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,5-dioxoimidazolidin-4-ylidene]guanidine |
|---|---|
| PubChem CID | 177462805 |
| Molecular Formula | C9H13N5O5 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (1E)-1-[3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,5-dioxoimidazolidin-4-ylidene]guanidine |
| SMILES | [H]/N=C(N)/N=C1\C(=O)NC(=O)N1[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C9H13N5O5/c10-8(11)12-6-7(17)13-9(18)14(6)5-1-3(16)4(2-15)19-5/h3-5,15-16H,1-2H2,(H3,10,11)(H,13,17,18)/b12-6+/t3-,4+,5+/m0/s1 |
| InChIKey | GNUPLVXMHRLKOX-SPZOUDFDSA-N |
| XLogP | -2.70 |
| TPSA | 161.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|