C10H11N5O7 — CID 172965121
2-imino-9-[(2R,3R,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6,8-dione (PubChem CID 172965121) has the molecular formula C10H11N5O7 and a molecular weight of 313.23 g/mol. Its IUPAC name is 2-imino-9-[(2R,3R,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6,8-dione.
| Compound Name | 2-imino-9-[(2R,3R,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6,8-dione |
|---|---|
| PubChem CID | 172965121 |
| Molecular Formula | C10H11N5O7 |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-imino-9-[(2R,3R,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6,8-dione |
| SMILES | [H]/N=C1/N=C2C(=NC(=O)N2[C@]2(O)O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1 |
| InChI | InChI=1S/C10H11N5O7/c11-8-13-6-3(7(19)14-8)12-9(20)15(6)10(21)5(18)4(17)2(1-16)22-10/h2,4-5,16-18,21H,1H2,(H2,11,14,19)/t2-,4-,5-,10-/m1/s1 |
| InChIKey | KVXWDOYGJZULKR-CFHHKUALSA-N |
| XLogP | -3.91 |
| TPSA | 188.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | -3.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|