C9H13N3O5 — CID 140510094
5-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-imino-5H-pyrimidin-4-one (PubChem CID 140510094) has the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. Its IUPAC name is 5-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-imino-5H-pyrimidin-4-one.
| Compound Name | 5-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-imino-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 140510094 |
| Molecular Formula | C9H13N3O5 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 5-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-imino-5H-pyrimidin-4-one |
| SMILES | [H]/N=C1\N=CC([C@@H]2O[C@H](CO)C(O)[C@@H]2O)C(=O)N1 |
| InChI | InChI=1S/C9H13N3O5/c10-9-11-1-3(8(16)12-9)7-6(15)5(14)4(2-13)17-7/h1,3-7,13-15H,2H2,(H2,10,12,16)/t3?,4-,5?,6+,7+/m1/s1 |
| InChIKey | JDUZKDOFCAHIRO-VRINEYRLSA-N |
| XLogP | -2.78 |
| TPSA | 135.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|