C11H14O6 — CID 158356577
6-[(2S,3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]cyclohex-4-ene-1,3-dione (PubChem CID 158356577) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is 6-[(2S,3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]cyclohex-4-ene-1,3-dione.
| Compound Name | 6-[(2S,3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]cyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 158356577 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 6-[(2S,3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]cyclohex-4-ene-1,3-dione |
| SMILES | O=C1C=CC([C@@H]2OC(CO)[C@@H](O)[C@H]2O)C(=O)C1 |
| InChI | InChI=1S/C11H14O6/c12-4-8-9(15)10(16)11(17-8)6-2-1-5(13)3-7(6)14/h1-2,6,8-12,15-16H,3-4H2/t6?,8?,9-,10-,11+/m1/s1 |
| InChIKey | GSYJILNXNNUALJ-XAYCWIAGSA-N |
| XLogP | -1.82 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|