C10H14N2O8 — CID 168992818
5-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-diazinane-2,4,6-trione (PubChem CID 168992818) has the molecular formula C10H14N2O8 and a molecular weight of 290.23 g/mol. Its IUPAC name is 5-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 168992818 |
| Molecular Formula | C10H14N2O8 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 5-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(C2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)N1 |
| InChI | InChI=1S/C10H14N2O8/c13-1-2-4(14)5(15)6(16)7(20-2)3-8(17)11-10(19)12-9(3)18/h2-7,13-16H,1H2,(H2,11,12,17,18,19)/t2-,4-,5+,6-,7?/m1/s1 |
| InChIKey | IBLRGSNXKPZCPY-VXYIQNCSSA-N |
| XLogP | -4.19 |
| TPSA | 165.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|