C18H18N2O7 — CID 155654314
1-(1,2-benzoxazol-3-ylmethyl)-3-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-pyridine-2,6-dione (PubChem CID 155654314) has the molecular formula C18H18N2O7 and a molecular weight of 374.35 g/mol. Its IUPAC name is 1-(1,2-benzoxazol-3-ylmethyl)-3-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-pyridine-2,6-dione.
| Compound Name | 1-(1,2-benzoxazol-3-ylmethyl)-3-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 155654314 |
| Molecular Formula | C18H18N2O7 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 1-(1,2-benzoxazol-3-ylmethyl)-3-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-pyridine-2,6-dione |
| SMILES | O=C1C=CC([C@@H]2O[C@H](CO)C(O)[C@@H]2O)C(=O)N1Cc1noc2ccccc12 |
| InChI | InChI=1S/C18H18N2O7/c21-8-13-15(23)16(24)17(26-13)10-5-6-14(22)20(18(10)25)7-11-9-3-1-2-4-12(9)27-19-11/h1-6,10,13,15-17,21,23-24H,7-8H2/t10?,13-,15?,16+,17+/m1/s1 |
| InChIKey | UVUZQUFVZXKTEJ-KTMLJZJXSA-N |
| XLogP | -0.65 |
| TPSA | 133.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|