C17H19N3O13P2 — CID 71515482
[(2R,3S,4R,5R)-5-[3-(1,2-benzoxazol-3-ylmethyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 71515482) has the molecular formula C17H19N3O13P2 and a molecular weight of 535.30 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[3-(1,2-benzoxazol-3-ylmethyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[3-(1,2-benzoxazol-3-ylmethyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 71515482 |
| Molecular Formula | C17H19N3O13P2 |
| Molecular Weight | 535.30 g/mol |
| Exact Mass | 535.04 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[3-(1,2-benzoxazol-3-ylmethyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)n1Cc1noc2ccccc12 |
| InChI | InChI=1S/C17H19N3O13P2/c21-13-5-6-19(17(24)20(13)7-10-9-3-1-2-4-11(9)32-18-10)16-15(23)14(22)12(31-16)8-30-35(28,29)33-34(25,26)27/h1-6,12,14-16,22-23H,7-8H2,(H,28,29)(H2,25,26,27)/t12-,14-,15-,16-/m1/s1 |
| InChIKey | WDMDPZUYDNAKEQ-DTZQCDIJSA-N |
| XLogP | -0.95 |
| TPSA | 233.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.30 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|