C17H15FN3O13P2-3 — CID 140617307
[[(2R,4S,5R)-5-[3-[(6-fluoro-1,2-benzoxazol-3-yl)methyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] phosphate (PubChem CID 140617307) has the molecular formula C17H15FN3O13P2-3 and a molecular weight of 550.26 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-[3-[(6-fluoro-1,2-benzoxazol-3-yl)methyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] phosphate.
| Compound Name | [[(2R,4S,5R)-5-[3-[(6-fluoro-1,2-benzoxazol-3-yl)methyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 140617307 |
| Molecular Formula | C17H15FN3O13P2-3 |
| Molecular Weight | 550.26 g/mol |
| Exact Mass | 550.01 |
| IUPAC Name | [[(2R,4S,5R)-5-[3-[(6-fluoro-1,2-benzoxazol-3-yl)methyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])[O-])C(O)[C@@H]2O)c(=O)n1Cc1noc2cc(F)ccc12 |
| InChI | InChI=1S/C17H18FN3O13P2/c18-8-1-2-9-10(19-33-11(9)5-8)6-21-13(22)3-4-20(17(21)25)16-15(24)14(23)12(32-16)7-31-36(29,30)34-35(26,27)28/h1-5,12,14-16,23-24H,6-7H2,(H,29,30)(H2,26,27,28)/p-3/t12-,14?,15+,16-/m1/s1 |
| InChIKey | QJHHTPLDQLTIBA-QSBXLFSZSA-K |
| XLogP | -2.71 |
| TPSA | 241.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.26 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|