C14H18N2O4S — CID 90624418
3-[(2,6-dimethylmorpholin-4-yl)sulfonylmethyl]-1,2-benzoxazole (PubChem CID 90624418) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 3-[(2,6-dimethylmorpholin-4-yl)sulfonylmethyl]-1,2-benzoxazole.
| Compound Name | 3-[(2,6-dimethylmorpholin-4-yl)sulfonylmethyl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 90624418 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3-[(2,6-dimethylmorpholin-4-yl)sulfonylmethyl]-1,2-benzoxazole |
| SMILES | CC1CN(S(=O)(=O)Cc2noc3ccccc23)CC(C)O1 |
| InChI | InChI=1S/C14H18N2O4S/c1-10-7-16(8-11(2)19-10)21(17,18)9-13-12-5-3-4-6-14(12)20-15-13/h3-6,10-11H,7-9H2,1-2H3 |
| InChIKey | SJSYIEPHTOPVMR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |