C15H20N2O3S — CID 90624410
3-[(3,5-dimethylpiperidin-1-yl)sulfonylmethyl]-1,2-benzoxazole (PubChem CID 90624410) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 3-[(3,5-dimethylpiperidin-1-yl)sulfonylmethyl]-1,2-benzoxazole.
| Compound Name | 3-[(3,5-dimethylpiperidin-1-yl)sulfonylmethyl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 90624410 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-[(3,5-dimethylpiperidin-1-yl)sulfonylmethyl]-1,2-benzoxazole |
| SMILES | CC1CC(C)CN(S(=O)(=O)Cc2noc3ccccc23)C1 |
| InChI | InChI=1S/C15H20N2O3S/c1-11-7-12(2)9-17(8-11)21(18,19)10-14-13-5-3-4-6-15(13)20-16-14/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | VURMTNKHXFOLCE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |