C14H17N3O4S — CID 90624533
1-[4-(1,2-benzoxazol-3-ylmethylsulfonyl)piperazin-1-yl]ethanone (PubChem CID 90624533) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is 1-[4-(1,2-benzoxazol-3-ylmethylsulfonyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(1,2-benzoxazol-3-ylmethylsulfonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 90624533 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1-[4-(1,2-benzoxazol-3-ylmethylsulfonyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(S(=O)(=O)Cc2noc3ccccc23)CC1 |
| InChI | InChI=1S/C14H17N3O4S/c1-11(18)16-6-8-17(9-7-16)22(19,20)10-13-12-4-2-3-5-14(12)21-15-13/h2-5H,6-10H2,1H3 |
| InChIKey | GTCSAAPIUOJLTC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |