C18H18ClN3O3S — CID 90624423
3-[[4-(3-chlorophenyl)piperazin-1-yl]sulfonylmethyl]-1,2-benzoxazole (PubChem CID 90624423) has the molecular formula C18H18ClN3O3S and a molecular weight of 391.88 g/mol. Its IUPAC name is 3-[[4-(3-chlorophenyl)piperazin-1-yl]sulfonylmethyl]-1,2-benzoxazole.
| Compound Name | 3-[[4-(3-chlorophenyl)piperazin-1-yl]sulfonylmethyl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 90624423 |
| Molecular Formula | C18H18ClN3O3S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 3-[[4-(3-chlorophenyl)piperazin-1-yl]sulfonylmethyl]-1,2-benzoxazole |
| SMILES | O=S(=O)(Cc1noc2ccccc12)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H18ClN3O3S/c19-14-4-3-5-15(12-14)21-8-10-22(11-9-21)26(23,24)13-17-16-6-1-2-7-18(16)25-20-17/h1-7,12H,8-11,13H2 |
| InChIKey | KOCAESKZRWHPDJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |