C20H23N5O4S — CID 91629604
[4-(1,2-benzoxazol-3-ylmethylsulfonyl)piperazin-1-yl]-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methanone (PubChem CID 91629604) has the molecular formula C20H23N5O4S and a molecular weight of 429.50 g/mol. Its IUPAC name is [4-(1,2-benzoxazol-3-ylmethylsulfonyl)piperazin-1-yl]-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methanone.
| Compound Name | [4-(1,2-benzoxazol-3-ylmethylsulfonyl)piperazin-1-yl]-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 91629604 |
| Molecular Formula | C20H23N5O4S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | [4-(1,2-benzoxazol-3-ylmethylsulfonyl)piperazin-1-yl]-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methanone |
| SMILES | O=C(c1cnn2c1CCCC2)N1CCN(S(=O)(=O)Cc2noc3ccccc23)CC1 |
| InChI | InChI=1S/C20H23N5O4S/c26-20(16-13-21-25-8-4-3-6-18(16)25)23-9-11-24(12-10-23)30(27,28)14-17-15-5-1-2-7-19(15)29-22-17/h1-2,5,7,13H,3-4,6,8-12,14H2 |
| InChIKey | PJDNOPDTNZFLJX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 101.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |