C11H13FO6 — CID 167031391
6-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione (PubChem CID 167031391) has the molecular formula C11H13FO6 and a molecular weight of 260.22 g/mol. Its IUPAC name is 6-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione.
| Compound Name | 6-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 167031391 |
| Molecular Formula | C11H13FO6 |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 6-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione |
| SMILES | O=C1CC(=O)C(C2OC(CO)C(O)C2O)C=C1F |
| InChI | InChI=1S/C11H13FO6/c12-5-1-4(6(14)2-7(5)15)11-10(17)9(16)8(3-13)18-11/h1,4,8-11,13,16-17H,2-3H2 |
| InChIKey | ZOYKASMVNURYJG-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|