About 6-[3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione
6-[3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione (PubChem CID 167031391) has the molecular formula C11H13FO6
and a molecular weight of 260.22 g/mol. Its IUPAC name is 6-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione.
Molecular Properties
| Compound Name | 6-[3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione |
| PubChem CID | 167031391 |
| Molecular Formula | C11H13FO6 |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 6-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione |
| SMILES | C1C(=O)C(C=C(C1=O)F)C2C(C(C(O2)CO)O)O |
| InChI | InChI=1S/C11H13FO6/c12-5-1-4(6(14)2-7(5)15)11-10(17)9(16)8(3-13)18-11/h1,4,8-11,13,16-17H,2-3H2 |
| InChIKey | ZOYKASMVNURYJG-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | 406 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 6-[3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione?
The IUPAC name of 6-[3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione (CID 167031391) is 6-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione.
What is the SMILES notation for 6-[3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione?
The canonical SMILES for 6-[3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione is C1C(=O)C(C=C(C1=O)F)C2C(C(C(O2)CO)O)O.
What is the InChIKey of 6-[3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione?
The InChIKey is ZOYKASMVNURYJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO6/c12-5-1-4(6(14)2-7(5)15)11-10(17)9(16)8(3-13)18-11/h1,4,8-11,13,16-17H,2-3H2.
What are the key properties of 6-[3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione?
6-[3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione has a molecular weight of 260.22 g/mol, XLogP of -1.10, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-fluorocyclohex-4-ene-1,3-dione is sourced from PubChem (CID 167031391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).