C13H14FNO6 — CID 146000375
3-[(3R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-prop-2-ynoxy-3H-pyridine-2,6-dione (PubChem CID 146000375) has the molecular formula C13H14FNO6 and a molecular weight of 299.25 g/mol. Its IUPAC name is 3-[(3R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-prop-2-ynoxy-3H-pyridine-2,6-dione.
| Compound Name | 3-[(3R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-prop-2-ynoxy-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 146000375 |
| Molecular Formula | C13H14FNO6 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 3-[(3R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-prop-2-ynoxy-3H-pyridine-2,6-dione |
| SMILES | C#CCOC1=CC(C2OC(CO)C(O)[C@H]2F)C(=O)NC1=O |
| InChI | InChI=1S/C13H14FNO6/c1-2-3-20-7-4-6(12(18)15-13(7)19)11-9(14)10(17)8(5-16)21-11/h1,4,6,8-11,16-17H,3,5H2,(H,15,18,19)/t6?,8?,9-,10?,11?/m1/s1 |
| InChIKey | KMRDNPDVFFWVAR-WZLNGYMUSA-N |
| XLogP | -1.75 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|