C15H28N3O11P2+ — CID 147471562
2-[[[(2R,5S)-3,4-dihydroxy-5-(6-imino-2-oxo-3H-pyridin-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 147471562) has the molecular formula C15H28N3O11P2+ and a molecular weight of 488.35 g/mol. Its IUPAC name is 2-[[[(2R,5S)-3,4-dihydroxy-5-(6-imino-2-oxo-3H-pyridin-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[[(2R,5S)-3,4-dihydroxy-5-(6-imino-2-oxo-3H-pyridin-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 147471562 |
| Molecular Formula | C15H28N3O11P2+ |
| Molecular Weight | 488.35 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 2-[[[(2R,5S)-3,4-dihydroxy-5-(6-imino-2-oxo-3H-pyridin-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | [H]/N=C1\C=CC([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OCC[N+](C)(C)C)C(O)C2O)C(=O)N1 |
| InChI | InChI=1S/C15H27N3O11P2/c1-18(2,3)6-7-26-30(22,23)29-31(24,25)27-8-10-12(19)13(20)14(28-10)9-4-5-11(16)17-15(9)21/h4-5,9-10,12-14,19-20H,6-8H2,1-3H3,(H3-,16,17,21,22,23,24,25)/p+1/t9?,10-,12?,13?,14+/m1/s1 |
| InChIKey | HSCUPJMBFHFBHF-XJEMYGLKSA-O |
| XLogP | -1.29 |
| TPSA | 204.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.35 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|