C10H17NO12P2+2 — CID 169316222
[(2R,3R,5S)-5-(2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-dihydroxy-trihydroxyphosphaniumyloxyphosphanium (PubChem CID 169316222) has the molecular formula C10H17NO12P2+2 and a molecular weight of 405.19 g/mol. Its IUPAC name is [(2R,3R,5S)-5-(2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-dihydroxy-trihydroxyphosphaniumyloxyphosphanium.
| Compound Name | [(2R,3R,5S)-5-(2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-dihydroxy-trihydroxyphosphaniumyloxyphosphanium |
|---|---|
| PubChem CID | 169316222 |
| Molecular Formula | C10H17NO12P2+2 |
| Molecular Weight | 405.19 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | [(2R,3R,5S)-5-(2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-dihydroxy-trihydroxyphosphaniumyloxyphosphanium |
| SMILES | O=C1C=CC([C@@H]2O[C@H](CO[P+](O)(O)O[P+](O)(O)O)[C@H](O)C2O)C(=O)N1 |
| InChI | InChI=1S/C10H16NO12P2/c12-6-2-1-4(10(15)11-6)9-8(14)7(13)5(22-9)3-21-25(19,20)23-24(16,17)18/h1-2,4-5,7-9,13-14,16-20H,3H2/q+1/p+1/t4?,5-,7+,8?,9+/m1/s1 |
| InChIKey | GPZDYTZPGMPDMG-ZXSWETMSSA-O |
| XLogP | -3.35 |
| TPSA | 215.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.19 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|