C10H13FNO9P — CID 168800537
[(2R,3S,4R,5S)-5-(5-fluoro-2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 168800537) has the molecular formula C10H13FNO9P and a molecular weight of 341.18 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-(5-fluoro-2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5S)-5-(5-fluoro-2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 168800537 |
| Molecular Formula | C10H13FNO9P |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | [(2R,3S,4R,5S)-5-(5-fluoro-2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=C1NC(=O)C([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)C=C1F |
| InChI | InChI=1S/C10H13FNO9P/c11-4-1-3(9(15)12-10(4)16)8-7(14)6(13)5(21-8)2-20-22(17,18)19/h1,3,5-8,13-14H,2H2,(H,12,15,16)(H2,17,18,19)/t3?,5-,6-,7-,8+/m1/s1 |
| InChIKey | WOVGIUYZUXSPHK-LNAOMTCKSA-N |
| XLogP | -2.29 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|