C15H19NO6 — CID 118488867
3-[(2S,3R,5R)-4-methoxy-5-(methoxymethyl)-3-prop-2-ynoxyoxolan-2-yl]-3H-pyridine-2,6-dione (PubChem CID 118488867) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is 3-[(2S,3R,5R)-4-methoxy-5-(methoxymethyl)-3-prop-2-ynoxyoxolan-2-yl]-3H-pyridine-2,6-dione.
| Compound Name | 3-[(2S,3R,5R)-4-methoxy-5-(methoxymethyl)-3-prop-2-ynoxyoxolan-2-yl]-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 118488867 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-[(2S,3R,5R)-4-methoxy-5-(methoxymethyl)-3-prop-2-ynoxyoxolan-2-yl]-3H-pyridine-2,6-dione |
| SMILES | C#CCO[C@H]1C(OC)[C@@H](COC)O[C@H]1C1C=CC(=O)NC1=O |
| InChI | InChI=1S/C15H19NO6/c1-4-7-21-14-12(9-5-6-11(17)16-15(9)18)22-10(8-19-2)13(14)20-3/h1,5-6,9-10,12-14H,7-8H2,2-3H3,(H,16,17,18)/t9?,10-,12+,13?,14-/m1/s1 |
| InChIKey | VUAFNEKHHURHLC-IBLKKDCCSA-N |
| XLogP | -0.74 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|