C21H29NO9 — CID 102320499
2-[3-[(2S,3S,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxypropoxy]isoindole-1,3-dione (PubChem CID 102320499) has the molecular formula C21H29NO9 and a molecular weight of 439.46 g/mol. Its IUPAC name is 2-[3-[(2S,3S,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxypropoxy]isoindole-1,3-dione.
| Compound Name | 2-[3-[(2S,3S,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxypropoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102320499 |
| Molecular Formula | C21H29NO9 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2-[3-[(2S,3S,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxypropoxy]isoindole-1,3-dione |
| SMILES | COC[C@H]1O[C@H](OCCCON2C(=O)c3ccccc3C2=O)[C@@H](OC)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C21H29NO9/c1-25-12-15-16(26-2)17(27-3)18(28-4)21(31-15)29-10-7-11-30-22-19(23)13-8-5-6-9-14(13)20(22)24/h5-6,8-9,15-18,21H,7,10-12H2,1-4H3/t15-,16-,17+,18+,21+/m1/s1 |
| InChIKey | ZIWCYJGBKQZDEX-QKIGPUQLSA-N |
| XLogP | 1.04 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|