C31H37NO7 — CID 102349712
2-[(2R,3R,4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)-2-(3-methylpentoxy)oxan-3-yl]naphtho[2,3-f]isoindole-1,3-dione (PubChem CID 102349712) has the molecular formula C31H37NO7 and a molecular weight of 535.64 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)-2-(3-methylpentoxy)oxan-3-yl]naphtho[2,3-f]isoindole-1,3-dione.
| Compound Name | 2-[(2R,3R,4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)-2-(3-methylpentoxy)oxan-3-yl]naphtho[2,3-f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102349712 |
| Molecular Formula | C31H37NO7 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | 2-[(2R,3R,4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)-2-(3-methylpentoxy)oxan-3-yl]naphtho[2,3-f]isoindole-1,3-dione |
| SMILES | CCC(C)CCO[C@@H]1O[C@H](COC)[C@@H](OC)[C@H](OC)[C@H]1N1C(=O)c2cc3cc4ccccc4cc3cc2C1=O |
| InChI | InChI=1S/C31H37NO7/c1-6-18(2)11-12-38-31-26(28(37-5)27(36-4)25(39-31)17-35-3)32-29(33)23-15-21-13-19-9-7-8-10-20(19)14-22(21)16-24(23)30(32)34/h7-10,13-16,18,25-28,31H,6,11-12,17H2,1-5H3/t18?,25-,26-,27-,28-,31-/m1/s1 |
| InChIKey | JCELXVCTNPIJIO-LVZMYNOMSA-N |
| XLogP | 4.81 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|