C16H24O5Se — CID 102307527
(2R,3R,4S,5R,6R)-2,4,5-trimethoxy-6-(methoxymethyl)-3-phenylselanyloxane (PubChem CID 102307527) has the molecular formula C16H24O5Se and a molecular weight of 375.32 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2,4,5-trimethoxy-6-(methoxymethyl)-3-phenylselanyloxane.
| Compound Name | (2R,3R,4S,5R,6R)-2,4,5-trimethoxy-6-(methoxymethyl)-3-phenylselanyloxane |
|---|---|
| PubChem CID | 102307527 |
| Molecular Formula | C16H24O5Se |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2,4,5-trimethoxy-6-(methoxymethyl)-3-phenylselanyloxane |
| SMILES | COC[C@H]1O[C@@H](OC)[C@H]([Se]c2ccccc2)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C16H24O5Se/c1-17-10-12-13(18-2)14(19-3)15(16(20-4)21-12)22-11-8-6-5-7-9-11/h5-9,12-16H,10H2,1-4H3/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | IPVSGSJKOZAZNU-IBEHDNSVSA-N |
| XLogP | 0.85 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|