C20H38O11 — CID 91701485
3,4,5-trimethoxy-2-(methoxymethyl)-6-[(2R,3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxane (PubChem CID 91701485) has the molecular formula C20H38O11 and a molecular weight of 454.51 g/mol. Its IUPAC name is 3,4,5-trimethoxy-2-(methoxymethyl)-6-[(2R,3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxane.
| Compound Name | 3,4,5-trimethoxy-2-(methoxymethyl)-6-[(2R,3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxane |
|---|---|
| PubChem CID | 91701485 |
| Molecular Formula | C20H38O11 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 3,4,5-trimethoxy-2-(methoxymethyl)-6-[(2R,3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxane |
| SMILES | COCC1OC(O[C@H]2O[C@H](COC)[C@@H](OC)[C@H](OC)[C@H]2OC)C(OC)C(OC)C1OC |
| InChI | InChI=1S/C20H38O11/c1-21-9-11-13(23-3)15(25-5)17(27-7)19(29-11)31-20-18(28-8)16(26-6)14(24-4)12(30-20)10-22-2/h11-20H,9-10H2,1-8H3/t11-,12?,13-,14?,15+,16?,17-,18?,19-,20?/m1/s1 |
| InChIKey | PREGLBRFCLDAND-HPWCKCNOSA-N |
| XLogP | -0.16 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |