C21H29NO8 — CID 102409191
2-[3-[(2S,3R,4R,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]propoxy]isoindole-1,3-dione (PubChem CID 102409191) has the molecular formula C21H29NO8 and a molecular weight of 423.46 g/mol. Its IUPAC name is 2-[3-[(2S,3R,4R,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]propoxy]isoindole-1,3-dione.
| Compound Name | 2-[3-[(2S,3R,4R,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]propoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102409191 |
| Molecular Formula | C21H29NO8 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 2-[3-[(2S,3R,4R,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]propoxy]isoindole-1,3-dione |
| SMILES | COC[C@H]1O[C@@H](CCCON2C(=O)c3ccccc3C2=O)[C@@H](OC)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C21H29NO8/c1-25-12-16-18(27-3)19(28-4)17(26-2)15(30-16)10-7-11-29-22-20(23)13-8-5-6-9-14(13)21(22)24/h5-6,8-9,15-19H,7,10-12H2,1-4H3/t15-,16+,17+,18+,19+/m0/s1 |
| InChIKey | ANSGYQYRPHMADY-UURKPOQGSA-N |
| XLogP | 1.45 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|