C14H28O6 — CID 102320502
4-[(2S,3R,4R,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]butan-1-ol (PubChem CID 102320502) has the molecular formula C14H28O6 and a molecular weight of 292.37 g/mol. Its IUPAC name is 4-[(2S,3R,4R,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]butan-1-ol.
| Compound Name | 4-[(2S,3R,4R,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 102320502 |
| Molecular Formula | C14H28O6 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 4-[(2S,3R,4R,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]butan-1-ol |
| SMILES | COC[C@H]1O[C@@H](CCCCO)[C@@H](OC)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C14H28O6/c1-16-9-11-13(18-3)14(19-4)12(17-2)10(20-11)7-5-6-8-15/h10-15H,5-9H2,1-4H3/t10-,11+,12+,13+,14+/m0/s1 |
| InChIKey | APLXXOUHGCPQMN-RYMFRWLXSA-N |
| XLogP | 0.61 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|