About CID 20741832
CID 20741832 (PubChem CID 20741832) has the molecular formula C8H15BO4
and a molecular weight of 186.02 g/mol.
Molecular Properties
| Compound Name | CID 20741832 |
| PubChem CID | 20741832 |
| Molecular Formula | C8H15BO4 |
| Molecular Weight | 186.02 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | — |
| SMILES | [B]C1OC(COC)C(OC)C1OC |
| InChI | InChI=1S/C8H15BO4/c1-10-4-5-6(11-2)7(12-3)8(9)13-5/h5-8H,4H2,1-3H3 |
| InChIKey | TUDVKMARPYQCSC-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.02 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 20741832 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20741832?
The IUPAC name of CID 20741832 (CID 20741832) is not available.
What is the SMILES notation for CID 20741832?
The canonical SMILES for CID 20741832 is [B]C1OC(COC)C(OC)C1OC.
What is the InChIKey of CID 20741832?
The InChIKey is TUDVKMARPYQCSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15BO4/c1-10-4-5-6(11-2)7(12-3)8(9)13-5/h5-8H,4H2,1-3H3.
What are the key properties of CID 20741832?
CID 20741832 has a molecular weight of 186.02 g/mol, XLogP of -0.44, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20741832 is sourced from PubChem (CID 20741832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).