C12H24BNO4 — CID 140753518
CID 140753518 (PubChem CID 140753518) has the molecular formula C12H24BNO4 and a molecular weight of 257.14 g/mol.
| Compound Name | CID 140753518 |
|---|---|
| PubChem CID | 140753518 |
| Molecular Formula | C12H24BNO4 |
| Molecular Weight | 257.14 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COC)C(OC)[C@@H]1OCC(CC)CN |
| InChI | InChI=1S/C12H24BNO4/c1-4-8(5-14)6-17-11-10(16-3)9(7-15-2)18-12(11)13/h8-12H,4-7,14H2,1-3H3/t8?,9-,10?,11+,12-/m1/s1 |
| InChIKey | VXLSLRGRNCYKFJ-MNRJGNLVSA-N |
| XLogP | -0.09 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.14 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|