About CID 21348493
CID 21348493 (PubChem CID 21348493) has the molecular formula C9H18BO3P
and a molecular weight of 216.03 g/mol.
Molecular Properties
| Compound Name | CID 21348493 |
| PubChem CID | 21348493 |
| Molecular Formula | C9H18BO3P |
| Molecular Weight | 216.03 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | — |
| SMILES | [B]C1OC(COC)C(OP(C)C)C1C |
| InChI | InChI=1S/C9H18BO3P/c1-6-8(13-14(3)4)7(5-11-2)12-9(6)10/h6-9H,5H2,1-4H3 |
| InChIKey | ONVRCHDSBWEHPL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.03 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 21348493 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21348493?
The IUPAC name of CID 21348493 (CID 21348493) is not available.
What is the SMILES notation for CID 21348493?
The canonical SMILES for CID 21348493 is [B]C1OC(COC)C(OP(C)C)C1C.
What is the InChIKey of CID 21348493?
The InChIKey is ONVRCHDSBWEHPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18BO3P/c1-6-8(13-14(3)4)7(5-11-2)12-9(6)10/h6-9H,5H2,1-4H3.
What are the key properties of CID 21348493?
CID 21348493 has a molecular weight of 216.03 g/mol, XLogP of 1.20, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21348493 is sourced from PubChem (CID 21348493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).