C18H17N3O8 — CID 177280083
2-[[(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methoxy]isoindole-1,3-dione (PubChem CID 177280083) has the molecular formula C18H17N3O8 and a molecular weight of 403.35 g/mol. Its IUPAC name is 2-[[(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methoxy]isoindole-1,3-dione.
| Compound Name | 2-[[(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 177280083 |
| Molecular Formula | C18H17N3O8 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 2-[[(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methoxy]isoindole-1,3-dione |
| SMILES | CO[C@H]1C(O)[C@@H](CON2C(=O)c3ccccc3C2=O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C18H17N3O8/c1-27-14-13(23)11(29-17(14)20-7-6-12(22)19-18(20)26)8-28-21-15(24)9-4-2-3-5-10(9)16(21)25/h2-7,11,13-14,17,23H,8H2,1H3,(H,19,22,26)/t11-,13?,14+,17-/m1/s1 |
| InChIKey | ROBQBUICAZCCNO-OVHGWZCWSA-N |
| XLogP | -0.96 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|