C17H15N3O9 — CID 174033729
2-[(2R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]peroxyisoindole-1,3-dione (PubChem CID 174033729) has the molecular formula C17H15N3O9 and a molecular weight of 405.32 g/mol. Its IUPAC name is 2-[(2R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]peroxyisoindole-1,3-dione.
| Compound Name | 2-[(2R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]peroxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 174033729 |
| Molecular Formula | C17H15N3O9 |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 2-[(2R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]peroxyisoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1OOC1C(O)[C@@H](CO)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C17H15N3O9/c21-7-10-12(23)13(16(27-10)19-6-5-11(22)18-17(19)26)28-29-20-14(24)8-3-1-2-4-9(8)15(20)25/h1-6,10,12-13,16,21,23H,7H2,(H,18,22,26)/t10-,12?,13?,16-/m1/s1 |
| InChIKey | NYGZRMDDHRKSOZ-VHBSBENZSA-N |
| XLogP | -1.68 |
| TPSA | 160.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|