C23H32NO8P — CID 10983685
N-diphenoxyphosphoryl-1-[(2R,3R,4R,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]methanamine (PubChem CID 10983685) has the molecular formula C23H32NO8P and a molecular weight of 481.48 g/mol. Its IUPAC name is N-diphenoxyphosphoryl-1-[(2R,3R,4R,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]methanamine.
| Compound Name | N-diphenoxyphosphoryl-1-[(2R,3R,4R,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]methanamine |
|---|---|
| PubChem CID | 10983685 |
| Molecular Formula | C23H32NO8P |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | N-diphenoxyphosphoryl-1-[(2R,3R,4R,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]methanamine |
| SMILES | COC[C@H]1O[C@H](CNP(=O)(Oc2ccccc2)Oc2ccccc2)[C@@H](OC)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C23H32NO8P/c1-26-16-20-22(28-3)23(29-4)21(27-2)19(30-20)15-24-33(25,31-17-11-7-5-8-12-17)32-18-13-9-6-10-14-18/h5-14,19-23H,15-16H2,1-4H3,(H,24,25)/t19-,20-,21-,22-,23-/m1/s1 |
| InChIKey | YLWORPGDTXEAEL-GNJRFXKQSA-N |
| XLogP | 3.30 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|