C23H32NO7P — CID 102325605
N-diphenoxyphosphoryl-2-[(2S,3S,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]ethanamine (PubChem CID 102325605) has the molecular formula C23H32NO7P and a molecular weight of 465.48 g/mol. Its IUPAC name is N-diphenoxyphosphoryl-2-[(2S,3S,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]ethanamine.
| Compound Name | N-diphenoxyphosphoryl-2-[(2S,3S,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]ethanamine |
|---|---|
| PubChem CID | 102325605 |
| Molecular Formula | C23H32NO7P |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-diphenoxyphosphoryl-2-[(2S,3S,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]ethanamine |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](CCNP(=O)(Oc2ccccc2)Oc2ccccc2)[C@@H]1OC |
| InChI | InChI=1S/C23H32NO7P/c1-17-21(26-2)23(28-4)22(27-3)20(29-17)15-16-24-32(25,30-18-11-7-5-8-12-18)31-19-13-9-6-10-14-19/h5-14,17,20-23H,15-16H2,1-4H3,(H,24,25)/t17-,20-,21-,22-,23+/m0/s1 |
| InChIKey | JWIVTLPNTBUKOZ-DIMAQAOGSA-N |
| XLogP | 4.06 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|