C11H14NO5P — CID 150064930
3-[[methoxy(phenoxy)phosphoryl]amino]oxolan-2-one (PubChem CID 150064930) has the molecular formula C11H14NO5P and a molecular weight of 271.21 g/mol. Its IUPAC name is 3-[[methoxy(phenoxy)phosphoryl]amino]oxolan-2-one.
| Compound Name | 3-[[methoxy(phenoxy)phosphoryl]amino]oxolan-2-one |
|---|---|
| PubChem CID | 150064930 |
| Molecular Formula | C11H14NO5P |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 3-[[methoxy(phenoxy)phosphoryl]amino]oxolan-2-one |
| SMILES | COP(=O)(NC1CCOC1=O)Oc1ccccc1 |
| InChI | InChI=1S/C11H14NO5P/c1-15-18(14,12-10-7-8-16-11(10)13)17-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H,12,14) |
| InChIKey | DOBSAERRKVPOLE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|