C14H20NO5P — CID 126605489
cyclopentyl 2-[[methoxy(phenoxy)phosphoryl]amino]acetate (PubChem CID 126605489) has the molecular formula C14H20NO5P and a molecular weight of 313.29 g/mol. Its IUPAC name is cyclopentyl 2-[[methoxy(phenoxy)phosphoryl]amino]acetate.
| Compound Name | cyclopentyl 2-[[methoxy(phenoxy)phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 126605489 |
| Molecular Formula | C14H20NO5P |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | cyclopentyl 2-[[methoxy(phenoxy)phosphoryl]amino]acetate |
| SMILES | COP(=O)(NCC(=O)OC1CCCC1)Oc1ccccc1 |
| InChI | InChI=1S/C14H20NO5P/c1-18-21(17,20-13-9-3-2-4-10-13)15-11-14(16)19-12-7-5-6-8-12/h2-4,9-10,12H,5-8,11H2,1H3,(H,15,17) |
| InChIKey | PHZKVBZINJSCAQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|