C13H16N2O4 — CID 43825760
N-(3-methoxyphenyl)-2-[(2-oxooxolan-3-yl)amino]acetamide (PubChem CID 43825760) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-[(2-oxooxolan-3-yl)amino]acetamide.
| Compound Name | N-(3-methoxyphenyl)-2-[(2-oxooxolan-3-yl)amino]acetamide |
|---|---|
| PubChem CID | 43825760 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-(3-methoxyphenyl)-2-[(2-oxooxolan-3-yl)amino]acetamide |
| SMILES | COc1cccc(NC(=O)CNC2CCOC2=O)c1 |
| InChI | InChI=1S/C13H16N2O4/c1-18-10-4-2-3-9(7-10)15-12(16)8-14-11-5-6-19-13(11)17/h2-4,7,11,14H,5-6,8H2,1H3,(H,15,16) |
| InChIKey | IOTIFSZLLYFFFC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |