C23H28NO8P — CID 123987343
benzyl [3-methyl-4-[[(2-oxooxolan-3-yl)amino]-phenoxyphosphoryl]oxybutan-2-yl] carbonate (PubChem CID 123987343) has the molecular formula C23H28NO8P and a molecular weight of 477.45 g/mol. Its IUPAC name is benzyl [3-methyl-4-[[(2-oxooxolan-3-yl)amino]-phenoxyphosphoryl]oxybutan-2-yl] carbonate.
| Compound Name | benzyl [3-methyl-4-[[(2-oxooxolan-3-yl)amino]-phenoxyphosphoryl]oxybutan-2-yl] carbonate |
|---|---|
| PubChem CID | 123987343 |
| Molecular Formula | C23H28NO8P |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | benzyl [3-methyl-4-[[(2-oxooxolan-3-yl)amino]-phenoxyphosphoryl]oxybutan-2-yl] carbonate |
| SMILES | CC(COP(=O)(NC1CCOC1=O)Oc1ccccc1)C(C)OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H28NO8P/c1-17(18(2)31-23(26)29-16-19-9-5-3-6-10-19)15-30-33(27,24-21-13-14-28-22(21)25)32-20-11-7-4-8-12-20/h3-12,17-18,21H,13-16H2,1-2H3,(H,24,27) |
| InChIKey | GQHPFIXWYDJDHA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|