C23H27N2O6P — CID 165145432
benzyl (2S)-2-[[[(2R)-3-oxo-1-azabicyclo[2.2.1]heptan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 165145432) has the molecular formula C23H27N2O6P and a molecular weight of 458.45 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R)-3-oxo-1-azabicyclo[2.2.1]heptan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2R)-3-oxo-1-azabicyclo[2.2.1]heptan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 165145432 |
| Molecular Formula | C23H27N2O6P |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | benzyl (2S)-2-[[[(2R)-3-oxo-1-azabicyclo[2.2.1]heptan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@@H]1C(=O)C2CCN1C2)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H27N2O6P/c1-17(23(27)29-15-18-8-4-2-5-9-18)24-32(28,31-20-10-6-3-7-11-20)30-16-21-22(26)19-12-13-25(21)14-19/h2-11,17,19,21H,12-16H2,1H3,(H,24,28)/t17-,19?,21+,32?/m0/s1 |
| InChIKey | WWXPYXIMAVACDT-SAHQUNDBSA-N |
| XLogP | 3.18 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|