C15H23NO6 — CID 171122762
(2S,3R,4S,5S,6R)-3-(4-aminophenoxy)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-ol (PubChem CID 171122762) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-3-(4-aminophenoxy)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-ol.
| Compound Name | (2S,3R,4S,5S,6R)-3-(4-aminophenoxy)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 171122762 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (2S,3R,4S,5S,6R)-3-(4-aminophenoxy)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-ol |
| SMILES | COC[C@H]1O[C@H](O)[C@H](Oc2ccc(N)cc2)[C@@H](OC)[C@H]1OC |
| InChI | InChI=1S/C15H23NO6/c1-18-8-11-12(19-2)13(20-3)14(15(17)22-11)21-10-6-4-9(16)5-7-10/h4-7,11-15,17H,8,16H2,1-3H3/t11-,12+,13+,14-,15+/m1/s1 |
| InChIKey | UQCMXIQSSCPWBK-FQKPHLNHSA-N |
| XLogP | 0.41 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|