C14H21NO6 — CID 54434556
(2S,3R,4R,5R,6R)-2-(4-aminophenoxy)-5-methoxy-6-(methoxymethyl)oxane-3,4-diol (PubChem CID 54434556) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-(4-aminophenoxy)-5-methoxy-6-(methoxymethyl)oxane-3,4-diol.
| Compound Name | (2S,3R,4R,5R,6R)-2-(4-aminophenoxy)-5-methoxy-6-(methoxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 54434556 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-(4-aminophenoxy)-5-methoxy-6-(methoxymethyl)oxane-3,4-diol |
| SMILES | COC[C@H]1O[C@@H](Oc2ccc(N)cc2)[C@H](O)[C@@H](O)[C@H]1OC |
| InChI | InChI=1S/C14H21NO6/c1-18-7-10-13(19-2)11(16)12(17)14(21-10)20-9-5-3-8(15)4-6-9/h3-6,10-14,16-17H,7,15H2,1-2H3/t10-,11-,12-,13+,14-/m1/s1 |
| InChIKey | WJVGIYCLCQUAES-XGFWRYKXSA-N |
| XLogP | -0.24 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|