C16H24N2O4 — CID 159790407
methane;2-[3-(3-methoxypropylamino)propoxy]isoindole-1,3-dione (PubChem CID 159790407) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is methane;2-[3-(3-methoxypropylamino)propoxy]isoindole-1,3-dione.
| Compound Name | methane;2-[3-(3-methoxypropylamino)propoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 159790407 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | methane;2-[3-(3-methoxypropylamino)propoxy]isoindole-1,3-dione |
| SMILES | C.COCCCNCCCON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H20N2O4.CH4/c1-20-10-4-8-16-9-5-11-21-17-14(18)12-6-2-3-7-13(12)15(17)19;/h2-3,6-7,16H,4-5,8-11H2,1H3;1H4 |
| InChIKey | NIMGTPMLZNBRPT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|